5BM
(2Z)-bis{amino[(2-aminophenyl)sulfanyl]methylidene}butanedinitrile
Find entries where: 5BM
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (2Z)-bis{amino[(2-aminophenyl)sulfanyl]methylidene}butanedinitrile |
| Identifiers | (2Z)-2,3-bis[amino-(2-aminophenyl)sulfanyl-methylidene]butanedinitrile |
| Formula | C18 H16 N6 S2 |
| Molecular Weight | 380.49 |
| Type | NON-POLYMER |
| Isomeric SMILES | c1ccc(c(c1)N)S/C(=C(\C#N)/C(=C(N)Sc2ccccc2N)C#N)/N |
| InChI | InChI=1S/C18H16N6S2/c19-9-11(17(23)25-15-7-3-1-5-13(15)21)12(10-20)18(24)26-16-8-4-2-6-14(16)22/h1-8H,21-24H2/b17-11+,18-12+ |
| InChIKey | DVEXZJFMOKTQEZ-JYFOCSDGSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 42 |
| Chiral Atom Count | 0 |
| Bond Count | 43 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB17060? |
|---|---|
| Name | U-0126 |
| Groups | investigational |
| Description | U-0126 is a direct inhibitor of the mitogen-activated protein-kinase kinase family members, MEK-1 and MEK-2.[A253162] |
| Synonyms |
|
| Categories |
|
| CAS number | 218601-62-8 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 3006531 |
| ChEMBL | CHEMBL34704 |
| ChEBI | CHEBI:90693, CHEBI:64208, CHEBI:91463 |
