Chemical Component Summary | |
|---|---|
| Name | CILOMILAST |
| Synonyms | CIS-4-CYANO-4-[3-(CYCLOPENTYLOXY)-4-METHOXYPHENYL]CYCLOHEXANECARBOXYLIC ACID |
| Identifiers | 4-cyano-4-(3-cyclopentyloxy-4-methoxy-phenyl)cyclohexane-1-carboxylic acid |
| Formula | C20 H25 N O4 |
| Molecular Weight | 343.417 |
| Type | NON-POLYMER |
| Isomeric SMILES | COc1ccc(cc1OC2CCCC2)C3(CCC(CC3)C(=O)O)C#N |
| InChI | InChI=1S/C20H25NO4/c1-24-17-7-6-15(12-18(17)25-16-4-2-3-5-16)20(13-21)10-8-14(9-11-20)19(22)23/h6-7,12,14,16H,2-5,8-11H2,1H3,(H,22,23)/t14-,20- |
| InChIKey | CFBUZOUXXHZCFB-OYOVHJISSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 50 |
| Chiral Atom Count | 0 |
| Bond Count | 52 |
| Aromatic Bond Count | 6 |
Drug Info: DrugBank
| DrugBank ID | DB03849? |
|---|---|
| Name | Cilomilast |
| Groups | investigational |
| Description | Cilomilast (Ariflo, SB-207,499) is a drug which was developed for the treatment of respiratory disorders such as asthma and Chronic Obstructive Pulmonary Disease (COPD). It is orally active and acts as a selective Phosphodiesterase-4 inhibitor. Following four clinical trials, the drug proved to be effective in treating COPD, however it has never been marketed due to a poor side effect profile. |
| Synonyms |
|
| Indication | Investigated for use/treatment in chronic obstructive pulmonary disease (COPD). |
| Categories |
|
| CAS number | 153259-65-5 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| cAMP-specific 3',5'-cyclic phosphodiesterase 4D | MEAEGSSAPARAGSGEGSDSAGGATLKAPKHLWRHEQHHQYPLRQPQFRL... | unknown | inhibitor |
| cAMP-specific 3',5'-cyclic phosphodiesterase 4B | MKKSRSVMTVMADDNVKDYFECSLSKSYSSSSNTLGIDLWRGRRCCSGNL... | unknown | inhibitor |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
