CIZ
(~{Z})-2-methylbut-2-enedioic acid
Find entries where: CIZ
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (~{Z})-2-methylbut-2-enedioic acid |
| Synonyms | CITRACONATE |
| Identifiers | (Z)-2-methylbut-2-enedioic acid |
| Formula | C5 H6 O4 |
| Molecular Weight | 130.099 |
| Type | NON-POLYMER |
| Isomeric SMILES | C/C(=C/C(=O)O)/C(=O)O |
| InChI | InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h2H,1H3,(H,6,7)(H,8,9)/b3-2- |
| InChIKey | HNEGQIOMVPPMNR-IHWYPQMZSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 15 |
| Chiral Atom Count | 0 |
| Bond Count | 14 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB04734? |
|---|---|
| Name | Citraconic acid |
| Groups | experimental |
| Description | Citraconic acid is one of the isomeric dicarboxylic acids produced by the distillation of citric acid, or as metabolites by microorganisms, cis-CH3-C(CO2H)=CHCO2H; the trans-isomer is mesaconic acid. |
| Synonyms |
|
| Categories |
|
| CAS number | 498-23-7 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Fumarate reductase flavoprotein subunit | ADNLAEFHVQNQECDSCHTPDGELSNDSLTYENTQCVSCHGTLEEVAETT... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 643798 |
| ChEBI | CHEBI:17626 |
| CCDC/CSD | WOQBIN, AMUCAO, NEDNOZ01, ZOTJIE, NEDNOZ |
| COD | 2007015 |
