DPR
D-PROLINE
Find entries where: DPR
is present as a standalone ligand in 3 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 1 entries
is present in a polymer sequence 214 entries
Chemical Component Summary | |
|---|---|
| Name | D-PROLINE |
| Identifiers | (2R)-pyrrolidine-2-carboxylic acid |
| Formula | C5 H9 N O2 |
| Molecular Weight | 115.13 |
| Type | D-PEPTIDE LINKING |
| Isomeric SMILES | C1C[C@@H](NC1)C(=O)O |
| InChI | InChI=1S/C5H9NO2/c7-5(8)4-2-1-3-6-4/h4,6H,1-3H2,(H,7,8)/t4-/m1/s1 |
| InChIKey | ONIBWKKTOPOVIA-SCSAIBSYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 17 |
| Chiral Atom Count | 1 |
| Bond Count | 17 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB02853? |
|---|---|
| Name | D-Proline |
| Groups | experimental |
| Description | D-proline is an isomer of the naturally occurring amino acid, L-Proline. D-amino acids have been found in relatively high abundance in human plasma and saliva [A19262]. These amino acids may be of bacterial origin, but there is also evidence that they are endogenously produced through amino acid racemase activity [A19263]. |
| Synonyms |
|
| CAS number | 344-25-2 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Proton-coupled amino acid transporter 1 | MSTQRLRNEDYHDYSSTDVSPEESPSEGLNNLSSPGSYQRFGQSNSTTWF... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 6971012, 8988 |
| ChEMBL | CHEMBL80257 |
| ChEBI | CHEBI:16313, CHEBI:57726 |
| CCDC/CSD | HUDRAC |
