DTU
(2R,3S)-1,4-DIMERCAPTOBUTANE-2,3-DIOL
Find entries where: DTU
is present as a standalone ligand in 34 entries
as a non-polymer is covalently linked to polymer or other heterogen groups 9 entries
Chemical Component Summary | |
|---|---|
| Name | (2R,3S)-1,4-DIMERCAPTOBUTANE-2,3-DIOL |
| Identifiers | (2S,3R)-1,4-bis-sulfanylbutane-2,3-diol |
| Formula | C4 H10 O2 S2 |
| Molecular Weight | 154.251 |
| Type | NON-POLYMER |
| Isomeric SMILES | C([C@H]([C@H](CS)O)O)S |
| InChI | InChI=1S/C4H10O2S2/c5-3(1-7)4(6)2-8/h3-8H,1-2H2/t3-,4+ |
| InChIKey | VHJLVAABSRFDPM-ZXZARUISSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 18 |
| Chiral Atom Count | 2 |
| Bond Count | 17 |
| Aromatic Bond Count | 0 |
Drug Info: DrugBank
| DrugBank ID | DB01692? |
|---|---|
| Name | Dithioerythritol |
| Groups | experimental |
| Description | A compound that, along with its isomer, Cleland's reagent (dithiothreitol), is used for the protection of sulfhydryl groups against oxidation to disulfides and for the reduction of disulfides to sulfhydryl groups. [PubChem] |
| Synonyms |
|
| Categories |
|
| CAS number | 6892-68-8 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Listeriolysin regulatory protein | MNAQAEEFKKYLETNGIKPKQFHKKELIFNQWDPQEYCIFLYDGITKLTS... | unknown | |
| 6,7-dimethyl-8-ribityllumazine synthase | MKGGAGVPDLPSLDASGVRLAIVASSWHGKICDALLDGARKVAAGCGLDD... | unknown | |
| Thymidine kinase, cytosolic | MSCINLPTVLPGSPSKTRGQIQVILGPMFSGKSTELMRRVRRFQIAQYKC... | unknown |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 439352 |
| ChEMBL | CHEMBL1232391 |
| ChEBI | CHEBI:17456 |
