Chemical Component Summary | |
|---|---|
| Name | Givinostat |
| Synonyms | {6-[(diethylamino)methyl]naphthalen-2-yl}methyl [4-(hydroxycarbamoyl)phenyl]carbamate |
| Identifiers | [6-(diethylaminomethyl)naphthalen-2-yl]methyl ~{N}-[4-(oxidanylcarbamoyl)phenyl]carbamate |
| Formula | C24 H27 N3 O4 |
| Molecular Weight | 421.489 |
| Type | NON-POLYMER |
| Isomeric SMILES | CCN(CC)Cc1ccc2cc(ccc2c1)COC(=O)Nc3ccc(cc3)C(=O)NO |
| InChI | InChI=1S/C24H27N3O4/c1-3-27(4-2)15-17-5-7-21-14-18(6-8-20(21)13-17)16-31-24(29)25-22-11-9-19(10-12-22)23(28)26-30/h5-14,30H,3-4,15-16H2,1-2H3,(H,25,29)(H,26,28) |
| InChIKey | YALNUENQHAQXEA-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 58 |
| Chiral Atom Count | 0 |
| Bond Count | 60 |
| Aromatic Bond Count | 17 |
Drug Info: DrugBank
| DrugBank ID | DB12645? |
|---|---|
| Name | Givinostat |
| Groups | investigational |
| Description | Givinostat has been used in trials studying the treatment of Polycythemia Vera, Juvenile Idiopathic Arthritis, Duchenne Muscular Dystrophy (DMD), Chronic Myeloproliferative Neoplasms, and Polyarticular Course Juvenile Idiopathic Arthritis. |
| Synonyms | Givinostat |
| Categories |
|
| CAS number | 497833-27-9 |
Drug Targets
| Name | Target Sequence | Pharmacological Action | Actions |
|---|---|---|---|
| Histone deacetylase | MAQTQGTRRKVCYYYDGDVGNYYYGQGHPMKPHRIRMTHNLLLNYGLYRK... | unknown | inhibitor |
Drug Info/Drug Targets: DrugBank 3.0: a comprehensive resource for 'omics' research on drugs. Knox C, Law V, Jewison
T, Liu P, Ly S, Frolkis A, Pon A, Banco K, Mak C, Neveu V, Djoumbou Y, Eisner R, Guo AC, Wishart DS.
Nucleic Acids Res. 2011 Jan; 39 (Database issue):D1035-41. | PMID:21059682
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL1213492 |
| PubChem | 9804992 |
| ChEMBL | CHEMBL1213492 |
| ChEBI | CHEBI:94187 |
