Chemical Component Summary | |
|---|---|
| Name | AR-42 |
| Synonyms | N-hydroxy-4-{[(2S)-3-methyl-2-phenylbutanoyl]amino}benzamide |
| Identifiers | 4-[[(2~{S})-3-methyl-2-phenyl-butanoyl]amino]-~{N}-oxidanyl-benzamide |
| Formula | C18 H20 N2 O3 |
| Molecular Weight | 312.363 |
| Type | NON-POLYMER |
| Isomeric SMILES | CC(C)[C@@H](c1ccccc1)C(=O)Nc2ccc(cc2)C(=O)NO |
| InChI | InChI=1S/C18H20N2O3/c1-12(2)16(13-6-4-3-5-7-13)18(22)19-15-10-8-14(9-11-15)17(21)20-23/h3-12,16,23H,1-2H3,(H,19,22)(H,20,21)/t16-/m0/s1 |
| InChIKey | LAMIXXKAWNLXOC-INIZCTEOSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 43 |
| Chiral Atom Count | 1 |
| Bond Count | 44 |
| Aromatic Bond Count | 12 |
Drug Info: DrugBank
| DrugBank ID | DB12707? |
|---|---|
| Name | AR-42 |
| Groups | investigational |
| Description | AR-42 has been used in trials studying the treatment of Meningioma, Acoustic Neuroma, Testicular Lymphoma, Intraocular Lymphoma, and Vestibular Schwannoma, among others. |
| Synonyms |
|
| CAS number | 935881-37-1 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL191482 |
| PubChem | 6918848 |
| ChEMBL | CHEMBL191482 |
