QQC
3-[(4-chloranyl-2-fluoranyl-phenyl)methyl]-2-methyl-~{N}-(5-methyl-1~{H}-pyrazol-3-yl)-8-(morpholin-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine
Find entries where: QQC
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | 3-[(4-chloranyl-2-fluoranyl-phenyl)methyl]-2-methyl-~{N}-(5-methyl-1~{H}-pyrazol-3-yl)-8-(morpholin-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| Identifiers | 3-[(4-chloranyl-2-fluoranyl-phenyl)methyl]-2-methyl-~{N}-(5-methyl-1~{H}-pyrazol-3-yl)-8-(morpholin-4-ylmethyl)imidazo[1,2-b]pyridazin-6-amine |
| Formula | C23 H25 Cl F N7 O |
| Molecular Weight | 469.942 |
| Type | NON-POLYMER |
| Isomeric SMILES | Cc1cc(n[nH]1)Nc2cc(c3nc(c(n3n2)Cc4ccc(cc4F)Cl)C)CN5CCOCC5 |
| InChI | InChI=1S/C23H25ClFN7O/c1-14-9-21(29-28-14)27-22-11-17(13-31-5-7-33-8-6-31)23-26-15(2)20(32(23)30-22)10-16-3-4-18(24)12-19(16)25/h3-4,9,11-12H,5-8,10,13H2,1-2H3,(H2,27,28,29,30) |
| InChIKey | SQSZANZGUXWJEA-UHFFFAOYSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 58 |
| Chiral Atom Count | 0 |
| Bond Count | 62 |
| Aromatic Bond Count | 21 |
Drug Info: DrugBank
| DrugBank ID | DB13040? |
|---|---|
| Name | Gandotinib |
| Groups | investigational |
| Description | Gandotinib has been used in trials studying the treatment of Myelofibrosis, Polycythemia Vera, Primary Myelofibrosis, Thrombocythemia, Essential, and Myeloproliferative Disorders, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 1229236-86-5 |
Related Resource References
| Resource Name | Reference |
|---|---|
| Pharos | CHEMBL2107823 |
| PubChem | 46213929 |
| ChEMBL | CHEMBL2107823 |
| ChEBI | CHEBI:188757 |
