ZJB
(2R,3R,4S,5R)-2-(3-AMINO-5-METHYL-1,4,5,6,8-PENTAAZAACENAPHTHYLEN-1(5H)-YL)-5-(HYDROXYMETHYL)TETRAHYDROFURAN-3,4-DIOL
Find entries where: ZJB
is present as a standalone ligand in 1 entries
Chemical Component Summary | |
|---|---|
| Name | (2R,3R,4S,5R)-2-(3-AMINO-5-METHYL-1,4,5,6,8-PENTAAZAACENAPHTHYLEN-1(5H)-YL)-5-(HYDROXYMETHYL)TETRAHYDROFURAN-3,4-DIOL |
| Formula | C13 H16 N6 O4 |
| Molecular Weight | 320.304 |
| Type | NON-POLYMER |
| Isomeric SMILES | CN1c2c3c(cn(c3ncn2)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)C(=N1)N |
| InChI | InChI=1S/C13H16N6O4/c1-18-11-7-5(10(14)17-18)2-19(12(7)16-4-15-11)13-9(22)8(21)6(3-20)23-13/h2,4,6,8-9,13,20-22H,3H2,1H3,(H2,14,17)/t6-,8-,9-,13-/m1/s1 |
| InChIKey | HOGVTUZUJGHKPL-HTVVRFAVSA-N |
Chemical Details | |
|---|---|
| Formal Charge | 0 |
| Atom Count | 39 |
| Chiral Atom Count | 4 |
| Bond Count | 42 |
| Aromatic Bond Count | 10 |
Drug Info: DrugBank
| DrugBank ID | DB12405? |
|---|---|
| Name | Triciribine |
| Groups | investigational |
| Description | Triciribine has been used in trials studying the treatment of Leukemia, Ovarian Cancer, HER2/Neu Negative, Breast Adenocarcinoma, and Stage IV Breast Cancer, among others. |
| Synonyms |
|
| Categories |
|
| CAS number | 35943-35-2 |
Related Resource References
| Resource Name | Reference |
|---|---|
| PubChem | 65399 |
| ChEMBL | CHEMBL331237 |
| ChEBI | CHEBI:65310 |
